C9H12ClNOS — CID 114299504
N-(1-chloropropan-2-yl)-3-methylthiophene-2-carboxamide (PubChem CID 114299504) has the molecular formula C9H12ClNOS and a molecular weight of 217.72 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-3-methylthiophene-2-carboxamide.
| Compound Name | N-(1-chloropropan-2-yl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 114299504 |
| Molecular Formula | C9H12ClNOS |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | N-(1-chloropropan-2-yl)-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)NC(C)CCl |
| InChI | InChI=1S/C9H12ClNOS/c1-6-3-4-13-8(6)9(12)11-7(2)5-10/h3-4,7H,5H2,1-2H3,(H,11,12) |
| InChIKey | VUHZECMWJVRTAH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|