C9H12ClNO2S — CID 83186616
3-chloro-N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide (PubChem CID 83186616) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is 3-chloro-N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 83186616 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 3-chloro-N-(4-hydroxybutan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(CCO)NC(=O)c1sccc1Cl |
| InChI | InChI=1S/C9H12ClNO2S/c1-6(2-4-12)11-9(13)8-7(10)3-5-14-8/h3,5-6,12H,2,4H2,1H3,(H,11,13) |
| InChIKey | AEPMXPCRGYQYKW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |