C9H10ClNO3S — CID 80645417
3-[(3-chlorothiophene-2-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 80645417) has the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. Its IUPAC name is 3-[(3-chlorothiophene-2-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[(3-chlorothiophene-2-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 80645417 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 3-[(3-chlorothiophene-2-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | CC(CNC(=O)c1sccc1Cl)C(=O)O |
| InChI | InChI=1S/C9H10ClNO3S/c1-5(9(13)14)4-11-8(12)7-6(10)2-3-15-7/h2-3,5H,4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | UQSVIBZWZCAMCS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |