C12H17Cl2NOS — CID 106254396
3-chloro-N-[2-(chloromethyl)-2-ethylbutyl]thiophene-2-carboxamide (PubChem CID 106254396) has the molecular formula C12H17Cl2NOS and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-chloro-N-[2-(chloromethyl)-2-ethylbutyl]thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-(chloromethyl)-2-ethylbutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106254396 |
| Molecular Formula | C12H17Cl2NOS |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-chloro-N-[2-(chloromethyl)-2-ethylbutyl]thiophene-2-carboxamide |
| SMILES | CCC(CC)(CCl)CNC(=O)c1sccc1Cl |
| InChI | InChI=1S/C12H17Cl2NOS/c1-3-12(4-2,7-13)8-15-11(16)10-9(14)5-6-17-10/h5-6H,3-4,7-8H2,1-2H3,(H,15,16) |
| InChIKey | DSEDWCXOYBARGM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|