C9H10ClNO3S — CID 80641030
ethyl 2-[(3-chlorothiophene-2-carbonyl)amino]acetate (PubChem CID 80641030) has the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. Its IUPAC name is ethyl 2-[(3-chlorothiophene-2-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(3-chlorothiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 80641030 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | ethyl 2-[(3-chlorothiophene-2-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1sccc1Cl |
| InChI | InChI=1S/C9H10ClNO3S/c1-2-14-7(12)5-11-9(13)8-6(10)3-4-15-8/h3-4H,2,5H2,1H3,(H,11,13) |
| InChIKey | TZDLMYTUHXOKDZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |