C12H14ClNO5S — CID 80642748
diethyl 2-[(3-chlorothiophene-2-carbonyl)amino]propanedioate (PubChem CID 80642748) has the molecular formula C12H14ClNO5S and a molecular weight of 319.77 g/mol. Its IUPAC name is diethyl 2-[(3-chlorothiophene-2-carbonyl)amino]propanedioate.
| Compound Name | diethyl 2-[(3-chlorothiophene-2-carbonyl)amino]propanedioate |
|---|---|
| PubChem CID | 80642748 |
| Molecular Formula | C12H14ClNO5S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | diethyl 2-[(3-chlorothiophene-2-carbonyl)amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1sccc1Cl)C(=O)OCC |
| InChI | InChI=1S/C12H14ClNO5S/c1-3-18-11(16)8(12(17)19-4-2)14-10(15)9-7(13)5-6-20-9/h5-6,8H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | PZLXWTMAQAUALU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|