C9H9BrClNO3S — CID 103492365
methyl 2-bromo-3-[(3-chlorothiophene-2-carbonyl)amino]propanoate (PubChem CID 103492365) has the molecular formula C9H9BrClNO3S and a molecular weight of 326.60 g/mol. Its IUPAC name is methyl 2-bromo-3-[(3-chlorothiophene-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(3-chlorothiophene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103492365 |
| Molecular Formula | C9H9BrClNO3S |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 324.92 |
| IUPAC Name | methyl 2-bromo-3-[(3-chlorothiophene-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)c1sccc1Cl |
| InChI | InChI=1S/C9H9BrClNO3S/c1-15-9(14)5(10)4-12-8(13)7-6(11)2-3-16-7/h2-3,5H,4H2,1H3,(H,12,13) |
| InChIKey | LNPVMZNCOIZNDJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|