C11H10BrCl2NO3 — CID 103492691
methyl 2-bromo-3-[(3,4-dichlorobenzoyl)amino]propanoate (PubChem CID 103492691) has the molecular formula C11H10BrCl2NO3 and a molecular weight of 355.02 g/mol. Its IUPAC name is methyl 2-bromo-3-[(3,4-dichlorobenzoyl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(3,4-dichlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 103492691 |
| Molecular Formula | C11H10BrCl2NO3 |
| Molecular Weight | 355.02 g/mol |
| Exact Mass | 352.92 |
| IUPAC Name | methyl 2-bromo-3-[(3,4-dichlorobenzoyl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10BrCl2NO3/c1-18-11(17)7(12)5-15-10(16)6-2-3-8(13)9(14)4-6/h2-4,7H,5H2,1H3,(H,15,16) |
| InChIKey | LCGQJUJRJKUYJF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.02 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|