C15H13Br2NO3 — CID 103492380
methyl 2-bromo-3-[(6-bromonaphthalene-2-carbonyl)amino]propanoate (PubChem CID 103492380) has the molecular formula C15H13Br2NO3 and a molecular weight of 415.08 g/mol. Its IUPAC name is methyl 2-bromo-3-[(6-bromonaphthalene-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(6-bromonaphthalene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103492380 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | methyl 2-bromo-3-[(6-bromonaphthalene-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C15H13Br2NO3/c1-21-15(20)13(17)8-18-14(19)11-3-2-10-7-12(16)5-4-9(10)6-11/h2-7,13H,8H2,1H3,(H,18,19) |
| InChIKey | JMGABSHEQFXSSZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|