C17H20BrNO — CID 115354023
6-bromo-N-(2,3-dimethylbutyl)naphthalene-2-carboxamide (PubChem CID 115354023) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is 6-bromo-N-(2,3-dimethylbutyl)naphthalene-2-carboxamide.
| Compound Name | 6-bromo-N-(2,3-dimethylbutyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 115354023 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 6-bromo-N-(2,3-dimethylbutyl)naphthalene-2-carboxamide |
| SMILES | CC(C)C(C)CNC(=O)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C17H20BrNO/c1-11(2)12(3)10-19-17(20)15-5-4-14-9-16(18)7-6-13(14)8-15/h4-9,11-12H,10H2,1-3H3,(H,19,20) |
| InChIKey | YJNRFIWZVVQRMS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |