C10H14ClNO2S2 — CID 106244209
3-chloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)thiophene-2-carboxamide (PubChem CID 106244209) has the molecular formula C10H14ClNO2S2 and a molecular weight of 279.81 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106244209 |
| Molecular Formula | C10H14ClNO2S2 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 3-chloro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)thiophene-2-carboxamide |
| SMILES | CSCC(C)(O)CNC(=O)c1sccc1Cl |
| InChI | InChI=1S/C10H14ClNO2S2/c1-10(14,6-15-2)5-12-9(13)8-7(11)3-4-16-8/h3-4,14H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | JMIGIALWXMHJBR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |