C13H19NO2S2 — CID 113239555
N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfanylbenzamide (PubChem CID 113239555) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfanylbenzamide.
| Compound Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 113239555 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-methylsulfanylbenzamide |
| SMILES | CSCC(C)(O)CNC(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C13H19NO2S2/c1-13(16,9-17-2)8-14-12(15)10-4-6-11(18-3)7-5-10/h4-7,16H,8-9H2,1-3H3,(H,14,15) |
| InChIKey | WTWUYOASCNGKCD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |