C12H12F5NO2S — CID 106244759
2,3,4,5,6-pentafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)benzamide (PubChem CID 106244759) has the molecular formula C12H12F5NO2S and a molecular weight of 329.29 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 106244759 |
| Molecular Formula | C12H12F5NO2S |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)benzamide |
| SMILES | CSCC(C)(O)CNC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO2S/c1-12(20,4-21-2)3-18-11(19)5-6(13)8(15)10(17)9(16)7(5)14/h20H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | NIDVPVPFDKTXFY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|