C10H10F3NOS — CID 78791752
4-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 78791752) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is 4-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 78791752 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 4-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CSc1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NOS/c1-16-8-4-2-7(3-5-8)9(15)14-6-10(11,12)13/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | CXTYREMZIVVJJC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |