C10H12N2OS2 — CID 80745015
N-(1-aminopropan-2-yl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 80745015) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(1-aminopropan-2-yl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 80745015 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N-(1-aminopropan-2-yl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | CC(CN)NC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H12N2OS2/c1-6(5-11)12-10(13)9-4-8-7(15-9)2-3-14-8/h2-4,6H,5,11H2,1H3,(H,12,13) |
| InChIKey | XKMOXRYPAYJWNJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |