C10H9NO3S2 — CID 80729193
2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid (PubChem CID 80729193) has the molecular formula C10H9NO3S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid.
| Compound Name | 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 80729193 |
| Molecular Formula | C10H9NO3S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid |
| SMILES | CC(NC(=O)c1cc2sccc2s1)C(=O)O |
| InChI | InChI=1S/C10H9NO3S2/c1-5(10(13)14)11-9(12)8-4-7-6(16-8)2-3-15-7/h2-5H,1H3,(H,11,12)(H,13,14) |
| InChIKey | PJNYAQJYQAXTCU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |