2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid

C10H9NO3S2 — CID 80729193

IUPAC2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid
SMILESCC(NC(=O)c1cc2sccc2s1)C(=O)O
InChIInChI=1S/C10H9NO3S2/c1-5(10(13)14)11-9(12)8-4-7-6(16-8)2-3-15-7/h2-5H,1H3,(H,11,12)(H,13,14)
InChIKeyPJNYAQJYQAXTCU-UHFFFAOYSA-N
MW255.32 g/mol
LogP2.17
Rot. Bonds3

About 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid

2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid (PubChem CID 80729193) has the molecular formula C10H9NO3S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid.

Molecular Properties

Compound Name2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid
PubChem CID80729193
Molecular FormulaC10H9NO3S2
Molecular Weight255.32 g/mol
Exact Mass255.00
IUPAC Name2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid
SMILESCC(NC(=O)c1cc2sccc2s1)C(=O)O
InChIInChI=1S/C10H9NO3S2/c1-5(10(13)14)11-9(12)8-4-7-6(16-8)2-3-15-7/h2-5H,1H3,(H,11,12)(H,13,14)
InChIKeyPJNYAQJYQAXTCU-UHFFFAOYSA-N
XLogP2.17
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.32
LogP ≤ 52.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid?
The IUPAC name of 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid (CID 80729193) is 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid.
What is the SMILES notation for 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid?
The canonical SMILES for 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid is CC(NC(=O)c1cc2sccc2s1)C(=O)O.
What is the InChIKey of 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid?
The InChIKey is PJNYAQJYQAXTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3S2/c1-5(10(13)14)11-9(12)8-4-7-6(16-8)2-3-15-7/h2-5H,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid?
2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid has a molecular weight of 255.32 g/mol, XLogP of 2.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thieno[3,2-b]thiophene-5-carbonylamino)propanoic acid is sourced from PubChem (CID 80729193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).