C12H11NO5S2 — CID 80733821
(2S)-2-(thieno[3,2-b]thiophene-5-carbonylamino)pentanedioic acid (PubChem CID 80733821) has the molecular formula C12H11NO5S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2S)-2-(thieno[3,2-b]thiophene-5-carbonylamino)pentanedioic acid.
| Compound Name | (2S)-2-(thieno[3,2-b]thiophene-5-carbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 80733821 |
| Molecular Formula | C12H11NO5S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | (2S)-2-(thieno[3,2-b]thiophene-5-carbonylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cc2sccc2s1)C(=O)O |
| InChI | InChI=1S/C12H11NO5S2/c14-10(15)2-1-6(12(17)18)13-11(16)9-5-8-7(20-9)3-4-19-8/h3-6H,1-2H2,(H,13,16)(H,14,15)(H,17,18)/t6-/m0/s1 |
| InChIKey | JWNDYIOPNOALMP-LURJTMIESA-N |
| XLogP | 2.01 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |