C8H7NO2S2 — CID 170138126
2-amino-2-hydroxy-1-thieno[3,2-b]thiophen-5-ylethanone (PubChem CID 170138126) has the molecular formula C8H7NO2S2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-amino-2-hydroxy-1-thieno[3,2-b]thiophen-5-ylethanone.
| Compound Name | 2-amino-2-hydroxy-1-thieno[3,2-b]thiophen-5-ylethanone |
|---|---|
| PubChem CID | 170138126 |
| Molecular Formula | C8H7NO2S2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | 2-amino-2-hydroxy-1-thieno[3,2-b]thiophen-5-ylethanone |
| SMILES | NC(O)C(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C8H7NO2S2/c9-8(11)7(10)6-3-5-4(13-6)1-2-12-5/h1-3,8,11H,9H2 |
| InChIKey | HALUEYIKQHJHHL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|