C8H5BrOS2 — CID 80738942
2-bromo-1-thieno[3,2-b]thiophen-5-ylethanone (PubChem CID 80738942) has the molecular formula C8H5BrOS2 and a molecular weight of 261.17 g/mol. Its IUPAC name is 2-bromo-1-thieno[3,2-b]thiophen-5-ylethanone.
| Compound Name | 2-bromo-1-thieno[3,2-b]thiophen-5-ylethanone |
|---|---|
| PubChem CID | 80738942 |
| Molecular Formula | C8H5BrOS2 |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | 2-bromo-1-thieno[3,2-b]thiophen-5-ylethanone |
| SMILES | O=C(CBr)c1cc2sccc2s1 |
| InChI | InChI=1S/C8H5BrOS2/c9-4-5(10)7-3-8-6(12-7)1-2-11-8/h1-3H,4H2 |
| InChIKey | YHNZCHVMMYLOBW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|