C10H10O2S2 — CID 115782915
2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanone (PubChem CID 115782915) has the molecular formula C10H10O2S2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanone.
| Compound Name | 2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanone |
|---|---|
| PubChem CID | 115782915 |
| Molecular Formula | C10H10O2S2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanone |
| SMILES | CCOCC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H10O2S2/c1-2-12-6-7(11)9-5-10-8(14-9)3-4-13-10/h3-5H,2,6H2,1H3 |
| InChIKey | NWQGXBMEHJYDCK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |