C11H12OS2 — CID 115787961
2-methyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-one (PubChem CID 115787961) has the molecular formula C11H12OS2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-methyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-one.
| Compound Name | 2-methyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-one |
|---|---|
| PubChem CID | 115787961 |
| Molecular Formula | C11H12OS2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-methyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-one |
| SMILES | CCC(C)C(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C11H12OS2/c1-3-7(2)11(12)10-6-9-8(14-10)4-5-13-9/h4-7H,3H2,1-2H3 |
| InChIKey | SCBMLPCDLUNXON-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |