C14H18BrNOS2 — CID 114168829
N-(2-bromo-3-ethylpentyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 114168829) has the molecular formula C14H18BrNOS2 and a molecular weight of 360.34 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 114168829 |
| Molecular Formula | C14H18BrNOS2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | CCC(CC)C(Br)CNC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H18BrNOS2/c1-3-9(4-2)10(15)8-16-14(17)13-7-12-11(19-13)5-6-18-12/h5-7,9-10H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | AGQQKSAHYJJCNO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|