C10H7NOS2 — CID 112732738
N-prop-2-ynylthieno[3,2-b]thiophene-5-carboxamide (PubChem CID 112732738) has the molecular formula C10H7NOS2 and a molecular weight of 221.31 g/mol. Its IUPAC name is N-prop-2-ynylthieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-prop-2-ynylthieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 112732738 |
| Molecular Formula | C10H7NOS2 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | N-prop-2-ynylthieno[3,2-b]thiophene-5-carboxamide |
| SMILES | C#CCNC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H7NOS2/c1-2-4-11-10(12)9-6-8-7(14-9)3-5-13-8/h1,3,5-6H,4H2,(H,11,12) |
| InChIKey | BOCSXGQPQBFSNM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|