C12H8FNOS — CID 18110082
5-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide (PubChem CID 18110082) has the molecular formula C12H8FNOS and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide.
| Compound Name | 5-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18110082 |
| Molecular Formula | C12H8FNOS |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 5-fluoro-N-prop-2-ynyl-1-benzothiophene-2-carboxamide |
| SMILES | C#CCNC(=O)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C12H8FNOS/c1-2-5-14-12(15)11-7-8-6-9(13)3-4-10(8)16-11/h1,3-4,6-7H,5H2,(H,14,15) |
| InChIKey | YDAFNGTYTDCTGV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|