C15H18FNO2S — CID 103919162
5-fluoro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide (PubChem CID 103919162) has the molecular formula C15H18FNO2S and a molecular weight of 295.38 g/mol. Its IUPAC name is 5-fluoro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-fluoro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 103919162 |
| Molecular Formula | C15H18FNO2S |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-fluoro-N-(6-hydroxyhexyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCCCCO)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C15H18FNO2S/c16-12-5-6-13-11(9-12)10-14(20-13)15(19)17-7-3-1-2-4-8-18/h5-6,9-10,18H,1-4,7-8H2,(H,17,19) |
| InChIKey | BXKINOZHBLVDGZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|