C12H11FINOS — CID 114503955
6-fluoro-N-(3-iodopropyl)-1-benzothiophene-2-carboxamide (PubChem CID 114503955) has the molecular formula C12H11FINOS and a molecular weight of 363.20 g/mol. Its IUPAC name is 6-fluoro-N-(3-iodopropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 6-fluoro-N-(3-iodopropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114503955 |
| Molecular Formula | C12H11FINOS |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 6-fluoro-N-(3-iodopropyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCI)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C12H11FINOS/c13-9-3-2-8-6-11(17-10(8)7-9)12(16)15-5-1-4-14/h2-3,6-7H,1,4-5H2,(H,15,16) |
| InChIKey | RHHUNGFTNRAXGA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|