C15H17BrFNOS — CID 106157587
N-(5-bromo-4-methylpentyl)-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 106157587) has the molecular formula C15H17BrFNOS and a molecular weight of 358.28 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(5-bromo-4-methylpentyl)-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106157587 |
| Molecular Formula | C15H17BrFNOS |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CC(CBr)CCCNC(=O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C15H17BrFNOS/c1-10(9-16)3-2-6-18-15(19)14-7-11-4-5-12(17)8-13(11)20-14/h4-5,7-8,10H,2-3,6,9H2,1H3,(H,18,19) |
| InChIKey | BODDSEADHXVZGC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|