C12H12FNO2S — CID 81104873
6-fluoro-N-[(2R)-1-hydroxypropan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 81104873) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-fluoro-N-[(2R)-1-hydroxypropan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 6-fluoro-N-[(2R)-1-hydroxypropan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 81104873 |
| Molecular Formula | C12H12FNO2S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 6-fluoro-N-[(2R)-1-hydroxypropan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H](CO)NC(=O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C12H12FNO2S/c1-7(6-15)14-12(16)11-4-8-2-3-9(13)5-10(8)17-11/h2-5,7,15H,6H2,1H3,(H,14,16)/t7-/m1/s1 |
| InChIKey | MRIKGQZACONHKC-SSDOTTSWSA-N |
| XLogP | 2.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |