C13H14FNO3S — CID 81104803
6-fluoro-N-(2-hydroxy-3-methoxypropyl)-1-benzothiophene-2-carboxamide (PubChem CID 81104803) has the molecular formula C13H14FNO3S and a molecular weight of 283.32 g/mol. Its IUPAC name is 6-fluoro-N-(2-hydroxy-3-methoxypropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 6-fluoro-N-(2-hydroxy-3-methoxypropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 81104803 |
| Molecular Formula | C13H14FNO3S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 6-fluoro-N-(2-hydroxy-3-methoxypropyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCC(O)CNC(=O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C13H14FNO3S/c1-18-7-10(16)6-15-13(17)12-4-8-2-3-9(14)5-11(8)19-12/h2-5,10,16H,6-7H2,1H3,(H,15,17) |
| InChIKey | PDLVEWYMFPUBIE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |