C14H10FNOS2 — CID 55689322
5-fluoro-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 55689322) has the molecular formula C14H10FNOS2 and a molecular weight of 291.37 g/mol. Its IUPAC name is 5-fluoro-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-fluoro-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55689322 |
| Molecular Formula | C14H10FNOS2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-fluoro-N-(thiophen-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCc1ccsc1)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C14H10FNOS2/c15-11-1-2-12-10(5-11)6-13(19-12)14(17)16-7-9-3-4-18-8-9/h1-6,8H,7H2,(H,16,17) |
| InChIKey | QGYLOAWUCUJNLJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |