C16H13NO2S — CID 115577883
N-[(4-hydroxyphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 115577883) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(4-hydroxyphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 115577883 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N-[(4-hydroxyphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(O)cc1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H13NO2S/c18-13-7-5-11(6-8-13)10-17-16(19)15-9-12-3-1-2-4-14(12)20-15/h1-9,18H,10H2,(H,17,19) |
| InChIKey | RDWVRXLDYAYFKY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |