C12H11F2NO2S — CID 113462659
N-(2,2-difluoro-3-hydroxypropyl)-1-benzothiophene-2-carboxamide (PubChem CID 113462659) has the molecular formula C12H11F2NO2S and a molecular weight of 271.29 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 113462659 |
| Molecular Formula | C12H11F2NO2S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC(F)(F)CO)c1cc2ccccc2s1 |
| InChI | InChI=1S/C12H11F2NO2S/c13-12(14,7-16)6-15-11(17)10-5-8-3-1-2-4-9(8)18-10/h1-5,16H,6-7H2,(H,15,17) |
| InChIKey | OUPJLVYDXSMVSO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |