C14H13F2NO2 — CID 104858075
N-(2,2-difluoro-3-hydroxypropyl)naphthalene-1-carboxamide (PubChem CID 104858075) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)naphthalene-1-carboxamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 104858075 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)naphthalene-1-carboxamide |
| SMILES | O=C(NCC(F)(F)CO)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H13F2NO2/c15-14(16,9-18)8-17-13(19)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,18H,8-9H2,(H,17,19) |
| InChIKey | XSPLLLVHJAUOEI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |