About 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide
4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide (PubChem CID 104857132) has the molecular formula C8H7Br2F2NO2S
and a molecular weight of 379.02 g/mol. Its IUPAC name is 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide |
| PubChem CID | 104857132 |
| Molecular Formula | C8H7Br2F2NO2S |
| Molecular Weight | 379.02 g/mol |
| Exact Mass | 376.85 |
| IUPAC Name | 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC(F)(F)CO)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H7Br2F2NO2S/c9-4-1-5(16-6(4)10)7(15)13-2-8(11,12)3-14/h1,14H,2-3H2,(H,13,15) |
| InChIKey | JLQBWTRSVOPAES-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.02 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide?
The IUPAC name of 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide (CID 104857132) is 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide.
What is the SMILES notation for 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide?
The canonical SMILES for 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide is O=C(NCC(F)(F)CO)c1cc(Br)c(Br)s1.
What is the InChIKey of 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide?
The InChIKey is JLQBWTRSVOPAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br2F2NO2S/c9-4-1-5(16-6(4)10)7(15)13-2-8(11,12)3-14/h1,14H,2-3H2,(H,13,15).
What are the key properties of 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide?
4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide has a molecular weight of 379.02 g/mol, XLogP of 2.63, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-carboxamide is sourced from PubChem (CID 104857132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).