C8H10Br2N2OS — CID 80537023
N-(3-aminopropyl)-4,5-dibromothiophene-2-carboxamide (PubChem CID 80537023) has the molecular formula C8H10Br2N2OS and a molecular weight of 342.06 g/mol. Its IUPAC name is N-(3-aminopropyl)-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(3-aminopropyl)-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80537023 |
| Molecular Formula | C8H10Br2N2OS |
| Molecular Weight | 342.06 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | N-(3-aminopropyl)-4,5-dibromothiophene-2-carboxamide |
| SMILES | NCCCNC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H10Br2N2OS/c9-5-4-6(14-7(5)10)8(13)12-3-1-2-11/h4H,1-3,11H2,(H,12,13) |
| InChIKey | QGEDRUZJXAOAGG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.06 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|