C7H6Br2N4OS — CID 80538796
N-(2-azidoethyl)-4,5-dibromothiophene-2-carboxamide (PubChem CID 80538796) has the molecular formula C7H6Br2N4OS and a molecular weight of 354.03 g/mol. Its IUPAC name is N-(2-azidoethyl)-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(2-azidoethyl)-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80538796 |
| Molecular Formula | C7H6Br2N4OS |
| Molecular Weight | 354.03 g/mol |
| Exact Mass | 351.86 |
| IUPAC Name | N-(2-azidoethyl)-4,5-dibromothiophene-2-carboxamide |
| SMILES | [N-]=[N+]=NCCNC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C7H6Br2N4OS/c8-4-3-5(15-6(4)9)7(14)11-1-2-12-13-10/h3H,1-2H2,(H,11,14) |
| InChIKey | GGYLOJGDFSROEF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.03 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|