C15H23Br2NOS — CID 80536454
4,5-dibromo-N-decylthiophene-2-carboxamide (PubChem CID 80536454) has the molecular formula C15H23Br2NOS and a molecular weight of 425.23 g/mol. Its IUPAC name is 4,5-dibromo-N-decylthiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-decylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 80536454 |
| Molecular Formula | C15H23Br2NOS |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 4,5-dibromo-N-decylthiophene-2-carboxamide |
| SMILES | CCCCCCCCCCNC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H23Br2NOS/c1-2-3-4-5-6-7-8-9-10-18-15(19)13-11-12(16)14(17)20-13/h11H,2-10H2,1H3,(H,18,19) |
| InChIKey | JLWKZLFODNLQTC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|