C12H13NO3S — CID 66176243
N-(2,3-dihydroxypropyl)-1-benzothiophene-2-carboxamide (PubChem CID 66176243) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 66176243 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC(O)CO)c1cc2ccccc2s1 |
| InChI | InChI=1S/C12H13NO3S/c14-7-9(15)6-13-12(16)11-5-8-3-1-2-4-10(8)17-11/h1-5,9,14-15H,6-7H2,(H,13,16) |
| InChIKey | VOJMFONVMDHDQD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |