C18H18N2O2S — CID 111784598
N-[2-(hydroxymethyl)-3-pyridin-2-ylpropyl]-1-benzothiophene-2-carboxamide (PubChem CID 111784598) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-3-pyridin-2-ylpropyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(hydroxymethyl)-3-pyridin-2-ylpropyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 111784598 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[2-(hydroxymethyl)-3-pyridin-2-ylpropyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC(CO)Cc1ccccn1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H18N2O2S/c21-12-13(9-15-6-3-4-8-19-15)11-20-18(22)17-10-14-5-1-2-7-16(14)23-17/h1-8,10,13,21H,9,11-12H2,(H,20,22) |
| InChIKey | KCDMTQOIVSZAFU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |