C16H20N2O3S — CID 110880623
N-(2-hydroxy-3-morpholin-4-ylpropyl)-1-benzothiophene-2-carboxamide (PubChem CID 110880623) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-(2-hydroxy-3-morpholin-4-ylpropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-hydroxy-3-morpholin-4-ylpropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110880623 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(2-hydroxy-3-morpholin-4-ylpropyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC(O)CN1CCOCC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H20N2O3S/c19-13(11-18-5-7-21-8-6-18)10-17-16(20)15-9-12-3-1-2-4-14(12)22-15/h1-4,9,13,19H,5-8,10-11H2,(H,17,20) |
| InChIKey | ROGZNJCCHANYTJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |