C16H20N2O4 — CID 97245650
N-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-1-benzofuran-3-carboxamide (PubChem CID 97245650) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-1-benzofuran-3-carboxamide.
| Compound Name | N-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 97245650 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-1-benzofuran-3-carboxamide |
| SMILES | O=C(NC[C@H](O)CN1CCOCC1)c1coc2ccccc12 |
| InChI | InChI=1S/C16H20N2O4/c19-12(10-18-5-7-21-8-6-18)9-17-16(20)14-11-22-15-4-2-1-3-13(14)15/h1-4,11-12,19H,5-10H2,(H,17,20)/t12-/m0/s1 |
| InChIKey | ULCFJEACZODAJO-LBPRGKRZSA-N |
| XLogP | 0.86 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |