C18H22N2O4 — CID 126839955
6-hydroxy-N-(2-hydroxy-3-morpholin-4-ylpropyl)naphthalene-1-carboxamide (PubChem CID 126839955) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 6-hydroxy-N-(2-hydroxy-3-morpholin-4-ylpropyl)naphthalene-1-carboxamide.
| Compound Name | 6-hydroxy-N-(2-hydroxy-3-morpholin-4-ylpropyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 126839955 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-hydroxy-N-(2-hydroxy-3-morpholin-4-ylpropyl)naphthalene-1-carboxamide |
| SMILES | O=C(NCC(O)CN1CCOCC1)c1cccc2cc(O)ccc12 |
| InChI | InChI=1S/C18H22N2O4/c21-14-4-5-16-13(10-14)2-1-3-17(16)18(23)19-11-15(22)12-20-6-8-24-9-7-20/h1-5,10,15,21-22H,6-9,11-12H2,(H,19,23) |
| InChIKey | IIZUMVKPCWEXKV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |