C23H24FN3O3 — CID 112799485
2-(4-fluorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)quinoline-4-carboxamide (PubChem CID 112799485) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 112799485 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)quinoline-4-carboxamide |
| SMILES | O=C(NCC(O)CN1CCOCC1)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H24FN3O3/c24-17-7-5-16(6-8-17)22-13-20(19-3-1-2-4-21(19)26-22)23(29)25-14-18(28)15-27-9-11-30-12-10-27/h1-8,13,18,28H,9-12,14-15H2,(H,25,29) |
| InChIKey | LZCONYNSDLOKKL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |