C20H19BrN2O — CID 5116892
2-(4-bromophenyl)-N-(2-methylpropyl)quinoline-4-carboxamide (PubChem CID 5116892) has the molecular formula C20H19BrN2O and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(2-methylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-bromophenyl)-N-(2-methylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5116892 |
| Molecular Formula | C20H19BrN2O |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(4-bromophenyl)-N-(2-methylpropyl)quinoline-4-carboxamide |
| SMILES | CC(C)CNC(=O)c1cc(-c2ccc(Br)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H19BrN2O/c1-13(2)12-22-20(24)17-11-19(14-7-9-15(21)10-8-14)23-18-6-4-3-5-16(17)18/h3-11,13H,12H2,1-2H3,(H,22,24) |
| InChIKey | BYZNBDUFQSKYDO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |