C24H19BrN2O — CID 2163425
2-(4-bromophenyl)-N-(3,5-dimethylphenyl)quinoline-4-carboxamide (PubChem CID 2163425) has the molecular formula C24H19BrN2O and a molecular weight of 431.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(3,5-dimethylphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-bromophenyl)-N-(3,5-dimethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2163425 |
| Molecular Formula | C24H19BrN2O |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-(4-bromophenyl)-N-(3,5-dimethylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cc(-c3ccc(Br)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C24H19BrN2O/c1-15-11-16(2)13-19(12-15)26-24(28)21-14-23(17-7-9-18(25)10-8-17)27-22-6-4-3-5-20(21)22/h3-14H,1-2H3,(H,26,28) |
| InChIKey | QRDODPVGAOWNML-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |