C12H10F3NO3 — CID 103726467
N-(3,3,3-trifluoro-2-hydroxypropyl)-1-benzofuran-3-carboxamide (PubChem CID 103726467) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-hydroxypropyl)-1-benzofuran-3-carboxamide.
| Compound Name | N-(3,3,3-trifluoro-2-hydroxypropyl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 103726467 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-(3,3,3-trifluoro-2-hydroxypropyl)-1-benzofuran-3-carboxamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1coc2ccccc12 |
| InChI | InChI=1S/C12H10F3NO3/c13-12(14,15)10(17)5-16-11(18)8-6-19-9-4-2-1-3-7(8)9/h1-4,6,10,17H,5H2,(H,16,18) |
| InChIKey | PTKYQFJXXIDUQA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |