C14H17NO3 — CID 115884333
N-(3-hydroxy-2-methylbutan-2-yl)-1-benzofuran-3-carboxamide (PubChem CID 115884333) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylbutan-2-yl)-1-benzofuran-3-carboxamide.
| Compound Name | N-(3-hydroxy-2-methylbutan-2-yl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 115884333 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-(3-hydroxy-2-methylbutan-2-yl)-1-benzofuran-3-carboxamide |
| SMILES | CC(O)C(C)(C)NC(=O)c1coc2ccccc12 |
| InChI | InChI=1S/C14H17NO3/c1-9(16)14(2,3)15-13(17)11-8-18-12-7-5-4-6-10(11)12/h4-9,16H,1-3H3,(H,15,17) |
| InChIKey | XABRYZZPZQHDFX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |