C12H11NO5 — CID 66165805
3-(1-benzofuran-3-carbonylamino)-2-hydroxypropanoic acid (PubChem CID 66165805) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 3-(1-benzofuran-3-carbonylamino)-2-hydroxypropanoic acid.
| Compound Name | 3-(1-benzofuran-3-carbonylamino)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66165805 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-(1-benzofuran-3-carbonylamino)-2-hydroxypropanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)c1coc2ccccc12 |
| InChI | InChI=1S/C12H11NO5/c14-9(12(16)17)5-13-11(15)8-6-18-10-4-2-1-3-7(8)10/h1-4,6,9,14H,5H2,(H,13,15)(H,16,17) |
| InChIKey | XBIDYACBBOHVTF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |