C13H14N2OS2 — CID 62665755
N-(3-amino-2-methyl-3-sulfanylidenepropyl)-1-benzothiophene-2-carboxamide (PubChem CID 62665755) has the molecular formula C13H14N2OS2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(3-amino-2-methyl-3-sulfanylidenepropyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 62665755 |
| Molecular Formula | C13H14N2OS2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(3-amino-2-methyl-3-sulfanylidenepropyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(CNC(=O)c1cc2ccccc2s1)C(N)=S |
| InChI | InChI=1S/C13H14N2OS2/c1-8(12(14)17)7-15-13(16)11-6-9-4-2-3-5-10(9)18-11/h2-6,8H,7H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | RZGKBADNCIWIBW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|