C16H20ClNOS — CID 107157129
N-(2-chloro-4,4-dimethylpentyl)-1-benzothiophene-2-carboxamide (PubChem CID 107157129) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107157129 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)CC(Cl)CNC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H20ClNOS/c1-16(2,3)9-12(17)10-18-15(19)14-8-11-6-4-5-7-13(11)20-14/h4-8,12H,9-10H2,1-3H3,(H,18,19) |
| InChIKey | NFCABIAPQLYRHQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|